Difference between revisions of "SJ18761"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1823 CPD-1823] == * common-name: ** nπ-methyl-l-histidine * smiles: ** cn1(c=nc=c1cc(c(=...")
(Created page with "Category:gene == Gene SJ11887 == == Organism(s) associated with this gene == * S.japonica_sterols_curated == Reaction(s) associated == * ATP_LPAREN_3h_RPAREN_tm *...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1823 CPD-1823] ==
+
== Gene SJ11887 ==
* common-name:
+
== Organism(s) associated with this gene  ==
** nπ-methyl-l-histidine
+
* [[S.japonica_sterols_curated]]
* smiles:
+
== Reaction(s) associated ==
** cn1(c=nc=c1cc(c(=o)[o-])[n+])
+
* [[ATP_LPAREN_3h_RPAREN_tm]]
* inchi-key:
+
** Category: [[orthology]]
** jdhildinmrgule-lurjtmiesa-n
+
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
* molecular-weight:
+
{{#set: organism associated=S.japonica_sterols_curated}}
** 169.183
+
{{#set: nb reaction associated=1}}
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
* [[X-METHYL-HIS-DIPEPTIDASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=nπ-methyl-l-histidine}}
 
{{#set: inchi-key=inchikey=jdhildinmrgule-lurjtmiesa-n}}
 
{{#set: molecular-weight=169.183}}
 

Revision as of 20:19, 18 December 2020

Gene SJ11887

Organism(s) associated with this gene

Reaction(s) associated