Difference between revisions of "SJ18787"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-20680 CPD-20680] == * common-name: ** diadinoxanthin * smiles: ** cc(c=cc=c(c#cc1(=c(c)cc(o...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OH-ACYL-ACP OH-ACYL-ACP] == * common-name: ** a (3r)-3-hydroxyacyl-[acyl-carrier protein] == Re...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-20680 CPD-20680] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OH-ACYL-ACP OH-ACYL-ACP] ==
 
* common-name:
 
* common-name:
** diadinoxanthin
+
** a (3r)-3-hydroxyacyl-[acyl-carrier protein]
* smiles:
 
** cc(c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)=cc=cc=c(c)c=cc=c(c)c=cc23(c(c)(c)cc(o)cc(c)(o2)3)
 
* inchi-key:
 
** oghzcsinimwcsb-ghiqlmqgsa-n
 
* molecular-weight:
 
** 582.865
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-19200]]
+
* [[3-HYDROXYDECANOYL-ACP-DEHYDR-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-19202]]
+
* [[3-OXOACYL-ACP-REDUCT-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=diadinoxanthin}}
+
{{#set: common-name=a (3r)-3-hydroxyacyl-[acyl-carrier protein]}}
{{#set: inchi-key=inchikey=oghzcsinimwcsb-ghiqlmqgsa-n}}
 
{{#set: molecular-weight=582.865}}
 

Revision as of 14:20, 26 August 2019

Metabolite OH-ACYL-ACP

  • common-name:
    • a (3r)-3-hydroxyacyl-[acyl-carrier protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a (3r)-3-hydroxyacyl-[acyl-carrier protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.