Difference between revisions of "SJ18793"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENYLOSUCC ADENYLOSUCC] == * common-name: ** adenylo-succinate * smiles: ** c(op(=o)([o-])[o-]...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3b-hydroxy-D5-steroids 3b-hydroxy-D5-steroids] == * common-name: ** a 3β-hydroxy-δ5-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENYLOSUCC ADENYLOSUCC] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3b-hydroxy-D5-steroids 3b-hydroxy-D5-steroids] ==
 
* common-name:
 
* common-name:
** adenylo-succinate
+
** a 3β-hydroxy-δ5-steroid
* smiles:
 
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n3(c=nc2(c(=nc=nc=23)nc(cc(=o)[o-])c(=o)[o-])))
 
* inchi-key:
 
** ofbhppmpbojxrt-dpxqiynjsa-j
 
* molecular-weight:
 
** 459.265
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[AAL_LPAREN_fum_RPAREN_]]
+
* [[1.1.1.145-RXN]]
* [[AMPSYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ADENYLOSUCCINATE-SYNTHASE-RXN]]
+
* [[1.1.1.145-RXN]]
* [[AMPSYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=adenylo-succinate}}
+
{{#set: common-name=a 3β-hydroxy-δ5-steroid}}
{{#set: inchi-key=inchikey=ofbhppmpbojxrt-dpxqiynjsa-j}}
 
{{#set: molecular-weight=459.265}}
 

Revision as of 14:20, 26 August 2019

Metabolite 3b-hydroxy-D5-steroids

  • common-name:
    • a 3β-hydroxy-δ5-steroid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality