Difference between revisions of "SJ18882"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-METHYL-CROTONYL-COA 3-METHYL-CROTONYL-COA] == * common-name: ** 3-methylcrotonyl-coa * smiles...")
(Created page with "Category:gene == Gene SJ18882 == * transcription-direction: ** positive * right-end-position: ** 30604 * left-end-position: ** 8794 * centisome-position: ** 3.7520747...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-METHYL-CROTONYL-COA 3-METHYL-CROTONYL-COA] ==
+
== Gene SJ18882 ==
−
* common-name:
+
* transcription-direction:
−
** 3-methylcrotonyl-coa
+
** positive
−
* smiles:
+
* right-end-position:
−
** cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
+
** 30604
−
* inchi-key:
+
* left-end-position:
−
** bxipalatiynhjn-zmhdxicwsa-j
+
** 8794
−
* molecular-weight:
+
* centisome-position:
−
** 845.604
+
** 3.7520747   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[ECH_LPAREN_3hivcoa_RPAREN_]]
+
* [[S.japonica_carotenoid_curated]]
−
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
+
== Reaction(s) associated ==
−
* [[RXN-14264]]
+
* [[RXN-9839]]
−
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
−
* [[ECH_LPAREN_3hivcoa_RPAREN_]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[IVCDH]]
+
** Category: [[orthology]]
−
* [[RXN-11921]]
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
−
* [[RXN-14264]]
+
== Pathway(s) associated ==
−
* [[RXN0-2301]]
+
* [[PWY-6082]]
−
== Reaction(s) of unknown directionality ==
+
** '''3''' reactions found over '''7''' reactions in the full pathway
−
{{#set: common-name=3-methylcrotonyl-coa}}
+
* [[PWY-6073]]
−
{{#set: inchi-key=inchikey=bxipalatiynhjn-zmhdxicwsa-j}}
+
** '''3''' reactions found over '''3''' reactions in the full pathway
−
{{#set: molecular-weight=845.604}}
+
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=30604}}
 +
{{#set: left-end-position=8794}}
 +
{{#set: centisome-position=3.7520747    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=2}}

Latest revision as of 11:01, 18 March 2021

Gene SJ18882

  • transcription-direction:
    • positive
  • right-end-position:
    • 30604
  • left-end-position:
    • 8794
  • centisome-position:
    • 3.7520747

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6082
    • 3 reactions found over 7 reactions in the full pathway
  • PWY-6073
    • 3 reactions found over 3 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ18882&oldid=131781"