Difference between revisions of "SJ18882"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-METHYL-CROTONYL-COA 3-METHYL-CROTONYL-COA] == * common-name: ** 3-methylcrotonyl-coa * smiles...")
(Created page with "Category:gene == Gene SJ02129 == * transcription-direction: ** negative * right-end-position: ** 74213 * left-end-position: ** 60083 * centisome-position: ** 42.51196...")
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-METHYL-CROTONYL-COA 3-METHYL-CROTONYL-COA] ==
+
== Gene SJ02129 ==
−
* common-name:
+
* transcription-direction:
−
** 3-methylcrotonyl-coa
+
** negative
−
* smiles:
+
* right-end-position:
−
** cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
+
** 74213
−
* inchi-key:
+
* left-end-position:
−
** bxipalatiynhjn-zmhdxicwsa-j
+
** 60083
−
* molecular-weight:
+
* centisome-position:
−
** 845.604
+
** 42.51196   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[ECH_LPAREN_3hivcoa_RPAREN_]]
+
* [[S.japonica_sterols_curated]]
−
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
+
== Reaction(s) associated ==
−
* [[RXN-14264]]
+
* [[DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
−
* [[ECH_LPAREN_3hivcoa_RPAREN_]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[IVCDH]]
+
== Pathway(s) associated ==
−
* [[RXN-11921]]
+
* [[TRIGLSYN-PWY]]
−
* [[RXN-14264]]
+
** '''5''' reactions found over '''7''' reactions in the full pathway
−
* [[RXN0-2301]]
+
{{#set: transcription-direction=negative}}
−
== Reaction(s) of unknown directionality ==
+
{{#set: right-end-position=74213}}
−
{{#set: common-name=3-methylcrotonyl-coa}}
+
{{#set: left-end-position=60083}}
−
{{#set: inchi-key=inchikey=bxipalatiynhjn-zmhdxicwsa-j}}
+
{{#set: centisome-position=42.51196    }}
−
{{#set: molecular-weight=845.604}}
+
{{#set: organism associated=S.japonica_sterols_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=1}}

Revision as of 20:19, 18 December 2020

Gene SJ02129

  • transcription-direction:
    • negative
  • right-end-position:
    • 74213
  • left-end-position:
    • 60083
  • centisome-position:
    • 42.51196

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • TRIGLSYN-PWY
    • 5 reactions found over 7 reactions in the full pathway




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ18882&oldid=40597"