Difference between revisions of "SJ18892"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2E-7Z-hexadeca-2-7-dienoyl-ACPs 2E-7Z-hexadeca-2-7-dienoyl-ACPs] == * common-name: ** a (2e,7z)...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9867 CPD-9867] == * common-name: ** 3-(all-trans-decaprenyl)benzene-1,2-diol * smiles: ** c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9867 CPD-9867] == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-(all-trans-decaprenyl)benzene-1,2-diol |
| + | * smiles: | ||
| + | ** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c)c)c | ||
| + | * inchi-key: | ||
| + | ** caujtfnfoamxrt-xrbhbmlssa-n | ||
| + | * molecular-weight: | ||
| + | ** 791.294 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-9233]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-(all-trans-decaprenyl)benzene-1,2-diol}} |
| + | {{#set: inchi-key=inchikey=caujtfnfoamxrt-xrbhbmlssa-n}} | ||
| + | {{#set: molecular-weight=791.294}} | ||
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-9867
- common-name:
- 3-(all-trans-decaprenyl)benzene-1,2-diol
- smiles:
- cc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c)c)c)c)c
- inchi-key:
- caujtfnfoamxrt-xrbhbmlssa-n
- molecular-weight:
- 791.294
