Difference between revisions of "SJ18981"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MI-HEXAKISPHOSPHATE MI-HEXAKISPHOSPHATE] == * common-name: ** phytate * smiles: ** c1(op([o-])(...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3766 CPD-3766] == * common-name: ** menadione * smiles: ** cc2(=cc(c1(c=cc=cc=1c2=o))=o) *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3766 CPD-3766] == |
* common-name: | * common-name: | ||
| − | ** | + | ** menadione |
* smiles: | * smiles: | ||
| − | ** | + | ** cc2(=cc(c1(c=cc=cc=1c2=o))=o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mjvavzpdrwsrrc-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 172.183 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[NADH-DEHYDROGENASE-QUINONE-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=menadione}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mjvavzpdrwsrrc-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=172.183}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-3766
- common-name:
- menadione
- smiles:
- cc2(=cc(c1(c=cc=cc=1c2=o))=o)
- inchi-key:
- mjvavzpdrwsrrc-uhfffaoysa-n
- molecular-weight:
- 172.183
