Difference between revisions of "SJ19026"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] == * common-name: ** glycerophosphoserine * smiles: ** c(o)c(o)cop([o-])(o...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYDROGEN-MOLECULE HYDROGEN-MOLECULE] == * common-name: ** h2 * smiles: ** [hh] * inchi-key: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2030 CPD0-2030] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HYDROGEN-MOLECULE HYDROGEN-MOLECULE] ==
 
* common-name:
 
* common-name:
** glycerophosphoserine
+
** h2
 
* smiles:
 
* smiles:
** c(o)c(o)cop([o-])(occ([n+])c(=o)[o-])=o
+
** [hh]
 
* inchi-key:
 
* inchi-key:
** zwzwygmenqvnfu-uhnvwzdzsa-m
+
** ufhflcqgniynrp-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 258.144
+
** 2.016
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14136]]
+
* [[HYDROG-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[HYDROG-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=glycerophosphoserine}}
+
{{#set: common-name=h2}}
{{#set: inchi-key=inchikey=zwzwygmenqvnfu-uhnvwzdzsa-m}}
+
{{#set: inchi-key=inchikey=ufhflcqgniynrp-uhfffaoysa-n}}
{{#set: molecular-weight=258.144}}
+
{{#set: molecular-weight=2.016}}

Revision as of 14:19, 26 August 2019

Metabolite HYDROGEN-MOLECULE

  • common-name:
    • h2
  • smiles:
    • [hh]
  • inchi-key:
    • ufhflcqgniynrp-uhfffaoysa-n
  • molecular-weight:
    • 2.016

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality