Difference between revisions of "SJ19108"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHOLANATE2 CHOLANATE2] == * common-name: ** 3α,12α-dihydroxy-7-oxo-5β-cholan-2...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15689 CPD-15689] == * common-name: ** (2e,5e)-dodeca-2,5-dienoyl-coa * smiles: ** ccccccc=c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15689 CPD-15689] == |
* common-name: | * common-name: | ||
− | ** | + | ** (2e,5e)-dodeca-2,5-dienoyl-coa |
* smiles: | * smiles: | ||
− | ** cc( | + | ** ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** zsjrxhrcabosnc-uovvplbnsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 941.776 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-14801]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(2e,5e)-dodeca-2,5-dienoyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zsjrxhrcabosnc-uovvplbnsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=941.776}} |
Revision as of 14:20, 26 August 2019
Contents
Metabolite CPD-15689
- common-name:
- (2e,5e)-dodeca-2,5-dienoyl-coa
- smiles:
- ccccccc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- zsjrxhrcabosnc-uovvplbnsa-j
- molecular-weight:
- 941.776