Difference between revisions of "SJ19146"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-194 CPD-194] == * common-name: ** 4-nitrophenyl phosphate * smiles: ** c1(=cc(op([o-])(=o)[...")
(Created page with "Category:gene == Gene SJ19146 == * transcription-direction: ** negative * right-end-position: ** 116200 * left-end-position: ** 110958 * centisome-position: ** 17.342255...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-194 CPD-194] ==
+
== Gene SJ19146 ==
* common-name:
+
* transcription-direction:
** 4-nitrophenyl phosphate
+
** negative
* smiles:
+
* right-end-position:
** c1(=cc(op([o-])(=o)[o-])=cc=c([n+]([o-])=o)1)
+
** 116200
* inchi-key:
+
* left-end-position:
** xzkihkmtemtjqx-uhfffaoysa-l
+
** 110958
* molecular-weight:
+
* centisome-position:
** 217.074
+
** 17.342255   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[3.4.25.1-RXN]]
{{#set: common-name=4-nitrophenyl phosphate}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=xzkihkmtemtjqx-uhfffaoysa-l}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=217.074}}
+
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=116200}}
 +
{{#set: left-end-position=110958}}
 +
{{#set: centisome-position=17.342255    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:02, 18 March 2021

Gene SJ19146

  • transcription-direction:
    • negative
  • right-end-position:
    • 116200
  • left-end-position:
    • 110958
  • centisome-position:
    • 17.342255

Organism(s) associated with this gene

Reaction(s) associated