Difference between revisions of "SJ19146"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-194 CPD-194] == * common-name: ** 4-nitrophenyl phosphate * smiles: ** c1(=cc(op([o-])(=o)[...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Uracil-54-in-tRNA Uracil-54-in-tRNA] == * common-name: ** a uracil54 in trna == Reaction(s) kno...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-194 CPD-194] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Uracil-54-in-tRNA Uracil-54-in-tRNA] ==
 
* common-name:
 
* common-name:
** 4-nitrophenyl phosphate
+
** a uracil54 in trna
* smiles:
 
** c1(=cc(op([o-])(=o)[o-])=cc=c([n+]([o-])=o)1)
 
* inchi-key:
 
** xzkihkmtemtjqx-uhfffaoysa-l
 
* molecular-weight:
 
** 217.074
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
+
* [[TRNA-URACIL-5--METHYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-nitrophenyl phosphate}}
+
{{#set: common-name=a uracil54 in trna}}
{{#set: inchi-key=inchikey=xzkihkmtemtjqx-uhfffaoysa-l}}
 
{{#set: molecular-weight=217.074}}
 

Revision as of 09:24, 27 August 2019

Metabolite Uracil-54-in-tRNA

  • common-name:
    • a uracil54 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality