Difference between revisions of "SJ19159"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-L-MYO-INOSITOL-1-P 1-L-MYO-INOSITOL-1-P] == * common-name: ** 1d-myo-inositol 3-monophosphate...")
(Created page with "Category:gene == Gene SJ19159 == * transcription-direction: ** negative * right-end-position: ** 311484 * left-end-position: ** 309603 * centisome-position: ** 48.389606...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-L-MYO-INOSITOL-1-P 1-L-MYO-INOSITOL-1-P] ==
+
== Gene SJ19159 ==
* common-name:
+
* transcription-direction:
** 1d-myo-inositol 3-monophosphate
+
** negative
* smiles:
+
* right-end-position:
** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)
+
** 311484
* inchi-key:
+
* left-end-position:
** inapmgsxuvuwaf-ptqmnwpwsa-l
+
** 309603
* molecular-weight:
+
* centisome-position:
** 258.121
+
** 48.389606   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[RXN-6501]]
+
== Reaction(s) associated ==
== Reaction(s) known to produce the compound ==
+
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
* [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]]
+
** Category: [[annotation]]
* [[RXN-10960]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN66-579]]
+
{{#set: transcription-direction=negative}}
== Reaction(s) of unknown directionality ==
+
{{#set: right-end-position=311484}}
{{#set: common-name=1d-myo-inositol 3-monophosphate}}
+
{{#set: left-end-position=309603}}
{{#set: inchi-key=inchikey=inapmgsxuvuwaf-ptqmnwpwsa-l}}
+
{{#set: centisome-position=48.389606    }}
{{#set: molecular-weight=258.121}}
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:03, 18 March 2021

Gene SJ19159

  • transcription-direction:
    • negative
  • right-end-position:
    • 311484
  • left-end-position:
    • 309603
  • centisome-position:
    • 48.389606

Organism(s) associated with this gene

Reaction(s) associated