Difference between revisions of "SJ19159"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-L-MYO-INOSITOL-1-P 1-L-MYO-INOSITOL-1-P] == * common-name: ** 1d-myo-inositol 3-monophosphate...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13793 CPD-13793] == * common-name: ** 3-oxo-24-ethyl-cholest-5-ene * smiles: ** ccc(c(c)c)c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-L-MYO-INOSITOL-1-P 1-L-MYO-INOSITOL-1-P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13793 CPD-13793] ==
 
* common-name:
 
* common-name:
** 1d-myo-inositol 3-monophosphate
+
** 3-oxo-24-ethyl-cholest-5-ene
 
* smiles:
 
* smiles:
** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)
+
** ccc(c(c)c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(=o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** inapmgsxuvuwaf-ptqmnwpwsa-l
+
** kyofijxmvnqyfc-xjzkhkohsa-n
 
* molecular-weight:
 
* molecular-weight:
** 258.121
+
** 412.698
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]]
+
* [[RXN-12789]]
* [[RXN-6501]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]]
+
* [[RXN-12789]]
* [[RXN-10960]]
 
* [[RXN66-579]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1d-myo-inositol 3-monophosphate}}
+
{{#set: common-name=3-oxo-24-ethyl-cholest-5-ene}}
{{#set: inchi-key=inchikey=inapmgsxuvuwaf-ptqmnwpwsa-l}}
+
{{#set: inchi-key=inchikey=kyofijxmvnqyfc-xjzkhkohsa-n}}
{{#set: molecular-weight=258.121}}
+
{{#set: molecular-weight=412.698}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-13793

  • common-name:
    • 3-oxo-24-ethyl-cholest-5-ene
  • smiles:
    • ccc(c(c)c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(=o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • kyofijxmvnqyfc-xjzkhkohsa-n
  • molecular-weight:
    • 412.698

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality