Difference between revisions of "SJ19257"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13713 CPD-13713] == * common-name: ** adenosine 5'-phosphoselenate * smiles: ** c(c3(c(c(c(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHYLAMINE METHYLAMINE] == * common-name: ** methylamine * smiles: ** c[n+] * inchi-key: ** ba...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13713 CPD-13713] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=METHYLAMINE METHYLAMINE] ==
 
* common-name:
 
* common-name:
** adenosine 5'-phosphoselenate
+
** methylamine
 
* smiles:
 
* smiles:
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(=o)([o-])o[se](=o)(=o)o
+
** c[n+]
 
* inchi-key:
 
* inchi-key:
** xcadvmzzfpierr-kqynxxcusa-m
+
** bavyzaluxzfzlv-uhfffaoysa-o
 
* molecular-weight:
 
* molecular-weight:
** 473.174
+
** 32.065
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12720]]
+
* [[RXN-10908]]
 +
* [[RXN-10913]]
 +
* [[RXN-8673]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=adenosine 5'-phosphoselenate}}
+
{{#set: common-name=methylamine}}
{{#set: inchi-key=inchikey=xcadvmzzfpierr-kqynxxcusa-m}}
+
{{#set: inchi-key=inchikey=bavyzaluxzfzlv-uhfffaoysa-o}}
{{#set: molecular-weight=473.174}}
+
{{#set: molecular-weight=32.065}}

Revision as of 14:20, 26 August 2019

Metabolite METHYLAMINE

  • common-name:
    • methylamine
  • smiles:
    • c[n+]
  • inchi-key:
    • bavyzaluxzfzlv-uhfffaoysa-o
  • molecular-weight:
    • 32.065

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality