Difference between revisions of "SJ19298"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE TREHALOSE] == * common-name: ** α,α-trehalose * smiles: ** c(c1(oc(c(c(c1...")
(Created page with "Category:gene == Gene SJ19298 == * transcription-direction: ** negative * right-end-position: ** 192091 * left-end-position: ** 188966 * centisome-position: ** 82.59726...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE TREHALOSE] ==
+
== Gene SJ19298 ==
* common-name:
+
* transcription-direction:
** α,α-trehalose
+
** negative
* smiles:
+
* right-end-position:
** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)co)o)o)o)))o
+
** 192091
* inchi-key:
+
* left-end-position:
** hdtrylnuvzcqoy-lizsdcnhsa-n
+
** 188966
* molecular-weight:
+
* centisome-position:
** 342.299
+
** 82.59726   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[TREHALA-RXN]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[TREHALOSEPHOSPHA-RXN]]
+
* [[RXN0-6731]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=α,α-trehalose}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=hdtrylnuvzcqoy-lizsdcnhsa-n}}
+
{{#set: transcription-direction=negative}}
{{#set: molecular-weight=342.299}}
+
{{#set: right-end-position=192091}}
 +
{{#set: left-end-position=188966}}
 +
{{#set: centisome-position=82.59726    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:01, 18 March 2021

Gene SJ19298

  • transcription-direction:
    • negative
  • right-end-position:
    • 192091
  • left-end-position:
    • 188966
  • centisome-position:
    • 82.59726

Organism(s) associated with this gene

Reaction(s) associated