Difference between revisions of "SJ19354"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] == * common-name: ** (2s,4s)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate * sm...")
(Created page with "Category:gene == Gene SJ19354 == * transcription-direction: ** negative * right-end-position: ** 173751 * left-end-position: ** 161298 * centisome-position: ** 70.63383...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] ==
+
== Gene SJ19354 ==
−
* common-name:
+
* transcription-direction:
−
** (2s,4s)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate
+
** negative
−
* smiles:
+
* right-end-position:
−
** c1(c(o)cc(=nc1c([o-])=o)c([o-])=o)
+
** 173751
−
* inchi-key:
+
* left-end-position:
−
** dvtpryhenfbcii-imjsidkusa-l
+
** 161298
−
* molecular-weight:
+
* centisome-position:
−
** 185.136
+
** 70.63383   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-14014]]
+
* [[S.japonica_carotenoid_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
* [[DIHYDRODIPICSYN-RXN]]
+
* [[RXN-13186]]
−
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
−
{{#set: common-name=(2s,4s)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: inchi-key=inchikey=dvtpryhenfbcii-imjsidkusa-l}}
+
* [[RXN-8660]]
−
{{#set: molecular-weight=185.136}}
+
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN-8661]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=173751}}
 +
{{#set: left-end-position=161298}}
 +
{{#set: centisome-position=70.63383    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=3}}

Latest revision as of 11:00, 18 March 2021

Gene SJ19354

  • transcription-direction:
    • negative
  • right-end-position:
    • 173751
  • left-end-position:
    • 161298
  • centisome-position:
    • 70.63383

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ19354&oldid=131667"