Difference between revisions of "SJ19354"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12221 CPD-12221] == * common-name: ** methyl bromide * smiles: ** cbr * inchi-key: ** gzuxj...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] == * common-name: ** (2s,4s)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate * sm...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14443 CPD-14443] == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2s,4s)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(c(o)cc(=nc1c([o-])=o)c([o-])=o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** dvtpryhenfbcii-imjsidkusa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 185.136 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-14014]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[DIHYDRODIPICSYN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2s,4s)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dvtpryhenfbcii-imjsidkusa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=185.136}} |
Revision as of 09:23, 27 August 2019
Contents
Metabolite CPD-14443
- common-name:
- (2s,4s)-4-hydroxy-2,3,4,5-tetrahydrodipicolinate
- smiles:
- c1(c(o)cc(=nc1c([o-])=o)c([o-])=o)
- inchi-key:
- dvtpryhenfbcii-imjsidkusa-l
- molecular-weight:
- 185.136
