Difference between revisions of "SJ19385"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLN == * common-name: ** l-glutamine * smiles: ** c(=o)(n)ccc([n+])c([o-])=o * inchi-key: ** zdxpyrjpndtmrx-vkhmyheasa-n * molecular-weig...") |
(Created page with "Category:gene == Gene SJ15446 == * transcription-direction: ** positive * right-end-position: ** 80221 * left-end-position: ** 59008 * centisome-position: ** 19.963327...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:gene]] |
| − | == | + | == Gene SJ15446 == |
| − | * | + | * transcription-direction: |
| − | ** | + | ** positive |
| − | * | + | * right-end-position: |
| − | ** | + | ** 80221 |
| − | * | + | * left-end-position: |
| − | ** | + | ** 59008 |
| − | * | + | * centisome-position: |
| − | ** | + | ** 19.963327 |
| − | == | + | == Organism(s) associated with this gene == |
| − | + | * [[S.japonica_carotenoid_curated]] | |
| − | * [[ | + | == Reaction(s) associated == |
| − | * [[ | + | * [[NITRATE-REDUCTASE-NADH-RXN]] |
| − | * [[ | + | ** Category: [[annotation]] |
| − | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[ | + | ** Category: [[orthology]] |
| − | * [[ | + | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a |
| − | + | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | * [[ | + | * [[NITRATE-REDUCTASE-NADPH-RXN]] |
| − | + | ** Category: [[annotation]] | |
| − | * [[ | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
| − | * [[ | + | ** Category: [[orthology]] |
| − | * [[ | + | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a |
| − | + | * [[NITRATE-REDUCTASE-NADPORNOPH-RXN]] | |
| − | * [[ | + | ** Category: [[annotation]] |
| − | * [[ | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
| − | + | ** Category: [[orthology]] | |
| − | * [[ | + | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a |
| − | * [[ | + | * [[NITRATREDUCT-RXN]] |
| − | * [[ | + | ** Category: [[annotation]] |
| − | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[ | + | == Pathway(s) associated == |
| − | + | * [[PWY-381]] | |
| − | + | ** '''3''' reactions found over '''3''' reactions in the full pathway | |
| − | * [[ | + | * [[PWY-5675]] |
| − | + | ** '''4''' reactions found over '''4''' reactions in the full pathway | |
| − | * [[ | + | {{#set: transcription-direction=positive}} |
| − | * [[ | + | {{#set: right-end-position=80221}} |
| − | * [[ | + | {{#set: left-end-position=59008}} |
| − | + | {{#set: centisome-position=19.963327 }} | |
| − | * [[ | + | {{#set: organism associated=S.japonica_carotenoid_curated}} |
| − | * [[ | + | {{#set: nb reaction associated=4}} |
| − | + | {{#set: nb pathway associated=2}} | |
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
Revision as of 11:12, 15 January 2021
Contents
Gene SJ15446
- transcription-direction:
- positive
- right-end-position:
- 80221
- left-end-position:
- 59008
- centisome-position:
- 19.963327
Organism(s) associated with this gene
Reaction(s) associated
- NITRATE-REDUCTASE-NADH-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: orthology
- source: output_pantograph_nannochloropsis_salina; tool: pantograph; comment: n.a
- source: output_pantograph_ectocarpus_siliculosus; tool: pantograph; comment: n.a
- Category: annotation
- NITRATE-REDUCTASE-NADPH-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: orthology
- source: output_pantograph_ectocarpus_siliculosus; tool: pantograph; comment: n.a
- Category: annotation
- NITRATE-REDUCTASE-NADPORNOPH-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: orthology
- source: output_pantograph_ectocarpus_siliculosus; tool: pantograph; comment: n.a
- Category: annotation
- NITRATREDUCT-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
Pathway(s) associated
- PWY-381
- 3 reactions found over 3 reactions in the full pathway
- PWY-5675
- 4 reactions found over 4 reactions in the full pathway
