Difference between revisions of "SJ19385"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLN == * common-name: ** l-glutamine * smiles: ** c(=o)(n)ccc([n+])c([o-])=o * inchi-key: ** zdxpyrjpndtmrx-vkhmyheasa-n * molecular-weig...") |
(Created page with "Category:gene == Gene SJ19385 == * transcription-direction: ** negative * right-end-position: ** 52622 * left-end-position: ** 23234 * centisome-position: ** 10.215666...") |
||
(2 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:gene]] |
− | == | + | == Gene SJ19385 == |
− | * | + | * transcription-direction: |
− | ** | + | ** negative |
− | * | + | * right-end-position: |
− | ** | + | ** 52622 |
− | * | + | * left-end-position: |
− | ** | + | ** 23234 |
− | * | + | * centisome-position: |
− | ** | + | ** 10.215666 |
− | == | + | == Organism(s) associated with this gene == |
− | + | * [[S.japonica_carotenoid_curated]] | |
− | * [[ | + | == Reaction(s) associated == |
− | * [[ | + | * [[RXN-15556]] |
− | * [[ | + | ** Category: [[orthology]] |
− | * | + | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a |
− | * | + | * [[UBIQUITIN--PROTEIN-LIGASE-RXN]] |
− | * [[ | + | ** Category: [[annotation]] |
− | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
− | * [[ | + | ** Category: [[orthology]] |
− | + | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
− | * | + | == Pathway(s) associated == |
− | * [[ | + | * [[PWY-7511]] |
− | * | + | ** '''7''' reactions found over '''9''' reactions in the full pathway |
− | * | + | {{#set: transcription-direction=negative}} |
− | * [[ | + | {{#set: right-end-position=52622}} |
− | + | {{#set: left-end-position=23234}} | |
− | * | + | {{#set: centisome-position=10.215666 }} |
− | * [[ | + | {{#set: organism associated=S.japonica_carotenoid_curated}} |
− | * | + | {{#set: nb reaction associated=2}} |
− | * | + | {{#set: nb pathway associated=1}} |
− | * [[ | ||
− | |||
− | |||
− | == | ||
− | * [[ | ||
− | * | ||
− | * | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | {{#set: |
Latest revision as of 11:10, 18 March 2021
Contents
Gene SJ19385
- transcription-direction:
- negative
- right-end-position:
- 52622
- left-end-position:
- 23234
- centisome-position:
- 10.215666
Organism(s) associated with this gene
Reaction(s) associated
- RXN-15556
- Category: orthology
- source: output_pantograph_ectocarpus_siliculosus; tool: pantograph; comment: n.a
- Category: orthology
- UBIQUITIN--PROTEIN-LIGASE-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: orthology
- source: output_pantograph_ectocarpus_siliculosus; tool: pantograph; comment: n.a
- Category: annotation
Pathway(s) associated
- PWY-7511
- 7 reactions found over 9 reactions in the full pathway