Difference between revisions of "SJ19385"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ22256 == * transcription-direction: ** positive * right-end-position: ** 208842 * left-end-position: ** 196253 * centisome-position: ** 33.681267...") |
(Created page with "Category:metabolite == Metabolite SCOPOLETIN == * common-name: ** scopoletin * smiles: ** coc2(c=c1(c(oc(=o)c=c1)=cc=2o)) * inchi-key: ** rodxrvnmmdrfik-uhfffaoysa-n * mol...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite SCOPOLETIN == |
− | * | + | * common-name: |
− | ** | + | ** scopoletin |
− | * | + | * smiles: |
− | ** | + | ** coc2(c=c1(c(oc(=o)c=c1)=cc=2o)) |
− | * | + | * inchi-key: |
− | ** | + | ** rodxrvnmmdrfik-uhfffaoysa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 192.171 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[RXN-14179]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=scopoletin}} | |
− | + | {{#set: inchi-key=inchikey=rodxrvnmmdrfik-uhfffaoysa-n}} | |
− | + | {{#set: molecular-weight=192.171}} | |
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Revision as of 14:53, 5 January 2021
Contents
Metabolite SCOPOLETIN
- common-name:
- scopoletin
- smiles:
- coc2(c=c1(c(oc(=o)c=c1)=cc=2o))
- inchi-key:
- rodxrvnmmdrfik-uhfffaoysa-n
- molecular-weight:
- 192.171