Difference between revisions of "SJ19385"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SCOPOLETIN == * common-name: ** scopoletin * smiles: ** coc2(c=c1(c(oc(=o)c=c1)=cc=2o)) * inchi-key: ** rodxrvnmmdrfik-uhfffaoysa-n * mol...") |
(Created page with "Category:gene == Gene SJ22256 == * transcription-direction: ** positive * right-end-position: ** 208842 * left-end-position: ** 196253 * centisome-position: ** 33.681267...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:gene]] |
| − | == | + | == Gene SJ22256 == |
| − | * | + | * transcription-direction: |
| − | ** | + | ** positive |
| − | * | + | * right-end-position: |
| − | ** | + | ** 208842 |
| − | * | + | * left-end-position: |
| − | ** | + | ** 196253 |
| − | * | + | * centisome-position: |
| − | ** | + | ** 33.681267 |
| − | == | + | == Organism(s) associated with this gene == |
| − | == Reaction(s) | + | * [[S.japonica_carotenoid_curated]] |
| − | * [[RXN- | + | == Reaction(s) associated == |
| − | == | + | * [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]] |
| − | {{#set: | + | ** Category: [[annotation]] |
| − | {{#set: | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
| − | {{#set: | + | ** Category: [[orthology]] |
| + | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | ||
| + | * [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]] | ||
| + | ** Category: [[annotation]] | ||
| + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | ||
| + | == Pathway(s) associated == | ||
| + | * [[PWY-1001]] | ||
| + | ** '''1''' reactions found over '''1''' reactions in the full pathway | ||
| + | {{#set: transcription-direction=positive}} | ||
| + | {{#set: right-end-position=208842}} | ||
| + | {{#set: left-end-position=196253}} | ||
| + | {{#set: centisome-position=33.681267 }} | ||
| + | {{#set: organism associated=S.japonica_carotenoid_curated}} | ||
| + | {{#set: nb reaction associated=2}} | ||
| + | {{#set: nb pathway associated=1}} | ||
Revision as of 15:24, 5 January 2021
Contents
Gene SJ22256
- transcription-direction:
- positive
- right-end-position:
- 208842
- left-end-position:
- 196253
- centisome-position:
- 33.681267
Organism(s) associated with this gene
Reaction(s) associated
- CELLULOSE-SYNTHASE-UDP-FORMING-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: orthology
- source: output_pantograph_ectocarpus_siliculosus; tool: pantograph; comment: n.a
- Category: annotation
- PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
Pathway(s) associated
- PWY-1001
- 1 reactions found over 1 reactions in the full pathway
