Difference between revisions of "SJ19455"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13533 CPD-13533] == * common-name: ** (3r)-3-hydroxypentanoyl-coa * smiles: ** ccc(cc(sccnc...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-DEOH-DEOXY-GLUCOSE DTDP-DEOH-DEOXY-GLUCOSE] == * common-name: ** dtdp-4-dehydro-6-deoxy-&a...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-DEOH-DEOXY-GLUCOSE DTDP-DEOH-DEOXY-GLUCOSE] == |
* common-name: | * common-name: | ||
− | ** | + | ** dtdp-4-dehydro-6-deoxy-α-d-glucopyranose |
* smiles: | * smiles: | ||
− | ** | + | ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(=o)c(o)c(o)2))o3)) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** psxwnitxwwecny-ucbtuhgzsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 544.302 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[DTDPDEHYDRHAMEPIM-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[DTDPGLUCDEHYDRAT-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=dtdp-4-dehydro-6-deoxy-α-d-glucopyranose}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=psxwnitxwwecny-ucbtuhgzsa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=544.302}} |
Revision as of 14:19, 26 August 2019
Contents
Metabolite DTDP-DEOH-DEOXY-GLUCOSE
- common-name:
- dtdp-4-dehydro-6-deoxy-α-d-glucopyranose
- smiles:
- cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(=o)c(o)c(o)2))o3))
- inchi-key:
- psxwnitxwwecny-ucbtuhgzsa-l
- molecular-weight:
- 544.302