Difference between revisions of "SJ19466"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13717 CPD-13717] == * common-name: ** l-selenocystathionine * smiles: ** c([se]cc(c([o-])=o...")
(Created page with "Category:gene == Gene SJ19466 == * transcription-direction: ** positive * right-end-position: ** 202353 * left-end-position: ** 197324 * centisome-position: ** 87.02233...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13717 CPD-13717] ==
+
== Gene SJ19466 ==
* common-name:
+
* transcription-direction:
** l-selenocystathionine
+
** positive
* smiles:
+
* right-end-position:
** c([se]cc(c([o-])=o)[n+])cc([n+])c(=o)[o-]
+
** 202353
* inchi-key:
+
* left-end-position:
** znwydqpouqrdly-whfbiakzsa-n
+
** 197324
* molecular-weight:
+
* centisome-position:
** 269.159
+
** 87.02233   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-12729]]
+
* [[S.japonica_carotenoid_curated]]
* [[RXN-15137]]
+
== Reaction(s) associated ==
== Reaction(s) known to produce the compound ==
+
* [[ADPART]]
* [[ACHMSSELCYSL]]
+
** Category: [[orthology]]
* [[ACHMSSELCYSLh]]
+
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
* [[RXN-12728]]
+
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
* [[SUCHMSSELCYSL]]
+
** Category: [[annotation]]
* [[SUCHMSSELCYSLh]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
== Reaction(s) of unknown directionality ==
+
** Category: [[orthology]]
{{#set: common-name=l-selenocystathionine}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
{{#set: inchi-key=inchikey=znwydqpouqrdly-whfbiakzsa-n}}
+
== Pathway(s) associated ==
{{#set: molecular-weight=269.159}}
+
* [[HISTSYN-PWY]]
 +
** '''10''' reactions found over '''10''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=202353}}
 +
{{#set: left-end-position=197324}}
 +
{{#set: centisome-position=87.02233    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:00, 18 March 2021

Gene SJ19466

  • transcription-direction:
    • positive
  • right-end-position:
    • 202353
  • left-end-position:
    • 197324
  • centisome-position:
    • 87.02233

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • HISTSYN-PWY
    • 10 reactions found over 10 reactions in the full pathway