Difference between revisions of "SJ19466"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Chitodextrins Chitodextrins] == * common-name: ** a chitodextrin == Reaction(s) known to consum...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13717 CPD-13717] == * common-name: ** l-selenocystathionine * smiles: ** c([se]cc(c([o-])=o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13717 CPD-13717] == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-selenocystathionine |
| + | * smiles: | ||
| + | ** c([se]cc(c([o-])=o)[n+])cc([n+])c(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** znwydqpouqrdly-whfbiakzsa-n | ||
| + | * molecular-weight: | ||
| + | ** 269.159 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12729]] |
| − | * [[RXN- | + | * [[RXN-15137]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ACHMSSELCYSL]] |
| + | * [[ACHMSSELCYSLh]] | ||
| + | * [[RXN-12728]] | ||
| + | * [[SUCHMSSELCYSL]] | ||
| + | * [[SUCHMSSELCYSLh]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-selenocystathionine}} |
| + | {{#set: inchi-key=inchikey=znwydqpouqrdly-whfbiakzsa-n}} | ||
| + | {{#set: molecular-weight=269.159}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-13717
- common-name:
- l-selenocystathionine
- smiles:
- c([se]cc(c([o-])=o)[n+])cc([n+])c(=o)[o-]
- inchi-key:
- znwydqpouqrdly-whfbiakzsa-n
- molecular-weight:
- 269.159
