Difference between revisions of "SJ19517"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8084 CPD-8084] == * common-name: ** 1-18:3-2-18:2-digalactosyldiacylglycerol * smiles: ** c...")
 
(Created page with "Category:gene == Gene SJ19517 == * transcription-direction: ** positive * right-end-position: ** 101858 * left-end-position: ** 94334 * centisome-position: ** 41.81972...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8084 CPD-8084] ==
+
== Gene SJ19517 ==
−
* common-name:
+
* transcription-direction:
−
** 1-18:3-2-18:2-digalactosyldiacylglycerol
+
** positive
−
* smiles:
+
* right-end-position:
−
** ccc=ccc=ccc=ccccccccc(occ(coc2(oc(coc1(oc(co)c(o)c(o)c(o)1))c(o)c(o)c(o)2))oc(=o)cccccccc=ccc=cccccc)=o
+
** 101858
−
* inchi-key:
+
* left-end-position:
−
** ohmfskzmpvonkq-ierpwchasa-n
+
** 94334
−
* molecular-weight:
+
* centisome-position:
−
** 939.231
+
** 41.81972   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-8311]]
+
* [[S.japonica_carotenoid_curated]]
−
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
−
* [[RXN-8310]]
+
* [[2.7.10.1-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
−
{{#set: common-name=1-18:3-2-18:2-digalactosyldiacylglycerol}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: inchi-key=inchikey=ohmfskzmpvonkq-ierpwchasa-n}}
+
* [[2.7.12.1-RXN]]
−
{{#set: molecular-weight=939.231}}
+
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[PROTEIN-KINASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
* [[RXN-14906]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=101858}}
 +
{{#set: left-end-position=94334}}
 +
{{#set: centisome-position=41.81972    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=4}}

Latest revision as of 11:01, 18 March 2021

Gene SJ19517

  • transcription-direction:
    • positive
  • right-end-position:
    • 101858
  • left-end-position:
    • 94334
  • centisome-position:
    • 41.81972

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ19517&oldid=131997"