Difference between revisions of "SJ19517"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17049 CPD-17049] == * common-name: ** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazi...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-236 CPD-236] == * common-name: ** gibberellin a29 * smiles: ** c=c1(c3(o)(cc4(c1)(c([ch]5(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17049 CPD-17049] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-236 CPD-236] ==
 
* common-name:
 
* common-name:
** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine
+
** gibberellin a29
 
* smiles:
 
* smiles:
** c(o)c2(s)(nc(=o)c(s)(cc1(=cc=cc=c1))nc(=o)2)
+
** c=c1(c3(o)(cc4(c1)(c([ch]5(c2(c(=o)oc(cc(o)c2)([ch](cc3)4)5)(c)))c([o-])=o)))
 
* inchi-key:
 
* inchi-key:
** vzgsjjjqzptkgr-vxgbxaggsa-n
+
** bkbyhsyzkiajda-lpemzmrwsa-m
 
* molecular-weight:
 
* molecular-weight:
** 298.374
+
** 347.387
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15684]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-113]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: common-name=gibberellin a29}}
{{#set: inchi-key=inchikey=vzgsjjjqzptkgr-vxgbxaggsa-n}}
+
{{#set: inchi-key=inchikey=bkbyhsyzkiajda-lpemzmrwsa-m}}
{{#set: molecular-weight=298.374}}
+
{{#set: molecular-weight=347.387}}

Revision as of 09:23, 27 August 2019

Metabolite CPD-236

  • common-name:
    • gibberellin a29
  • smiles:
    • c=c1(c3(o)(cc4(c1)(c([ch]5(c2(c(=o)oc(cc(o)c2)([ch](cc3)4)5)(c)))c([o-])=o)))
  • inchi-key:
    • bkbyhsyzkiajda-lpemzmrwsa-m
  • molecular-weight:
    • 347.387

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality