Difference between revisions of "SJ19532"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Polynucleotide-Holder Polynucleotide-Holder] == * common-name: ** a generic polynucleotide subs...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19167 CPD-19167] == * common-name: ** 3-oxo-(7z)-hexadecenoyl-coa * smiles: ** ccccccccc=cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Polynucleotide-Holder Polynucleotide-Holder] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19167 CPD-19167] ==
 
* common-name:
 
* common-name:
** a generic polynucleotide substrate
+
** 3-oxo-(7z)-hexadecenoyl-coa
 +
* smiles:
 +
** ccccccccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** bucifqoxnyheoo-ydggzukgsa-j
 +
* molecular-weight:
 +
** 1013.883
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.31.1-RXN]]
+
* [[RXN-17782]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[POLYNUCLEOTIDE-3-PHOSPHATASE-RXN]]
+
* [[RXN-17781]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a generic polynucleotide substrate}}
+
{{#set: common-name=3-oxo-(7z)-hexadecenoyl-coa}}
 +
{{#set: inchi-key=inchikey=bucifqoxnyheoo-ydggzukgsa-j}}
 +
{{#set: molecular-weight=1013.883}}

Revision as of 14:20, 26 August 2019

Metabolite CPD-19167

  • common-name:
    • 3-oxo-(7z)-hexadecenoyl-coa
  • smiles:
    • ccccccccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • bucifqoxnyheoo-ydggzukgsa-j
  • molecular-weight:
    • 1013.883

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality