Difference between revisions of "SJ19532"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19167 CPD-19167] == * common-name: ** 3-oxo-(7z)-hexadecenoyl-coa * smiles: ** ccccccccc=cc...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14123 CPD-14123] == * common-name: ** 3-amino-2,3-dideoxy-scyllo-inosose * smiles: ** c1(c(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14123 CPD-14123] == |
* common-name: | * common-name: | ||
− | ** 3- | + | ** 3-amino-2,3-dideoxy-scyllo-inosose |
* smiles: | * smiles: | ||
− | ** | + | ** c1(c([n+])c(o)c(o)c(o)c(=o)1) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** fsugckmutgkwie-ygivhsipsa-o |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 162.165 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-13118]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=3- | + | {{#set: common-name=3-amino-2,3-dideoxy-scyllo-inosose}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fsugckmutgkwie-ygivhsipsa-o}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=162.165}} |
Revision as of 09:24, 27 August 2019
Contents
Metabolite CPD-14123
- common-name:
- 3-amino-2,3-dideoxy-scyllo-inosose
- smiles:
- c1(c([n+])c(o)c(o)c(o)c(=o)1)
- inchi-key:
- fsugckmutgkwie-ygivhsipsa-o
- molecular-weight:
- 162.165