Difference between revisions of "SJ19532"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19167 CPD-19167] == * common-name: ** 3-oxo-(7z)-hexadecenoyl-coa * smiles: ** ccccccccc=cc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14123 CPD-14123] == * common-name: ** 3-amino-2,3-dideoxy-scyllo-inosose * smiles: ** c1(c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19167 CPD-19167] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14123 CPD-14123] ==
 
* common-name:
 
* common-name:
** 3-oxo-(7z)-hexadecenoyl-coa
+
** 3-amino-2,3-dideoxy-scyllo-inosose
 
* smiles:
 
* smiles:
** ccccccccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c1(c([n+])c(o)c(o)c(o)c(=o)1)
 
* inchi-key:
 
* inchi-key:
** bucifqoxnyheoo-ydggzukgsa-j
+
** fsugckmutgkwie-ygivhsipsa-o
 
* molecular-weight:
 
* molecular-weight:
** 1013.883
+
** 162.165
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17782]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17781]]
+
* [[RXN-13118]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-(7z)-hexadecenoyl-coa}}
+
{{#set: common-name=3-amino-2,3-dideoxy-scyllo-inosose}}
{{#set: inchi-key=inchikey=bucifqoxnyheoo-ydggzukgsa-j}}
+
{{#set: inchi-key=inchikey=fsugckmutgkwie-ygivhsipsa-o}}
{{#set: molecular-weight=1013.883}}
+
{{#set: molecular-weight=162.165}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-14123

  • common-name:
    • 3-amino-2,3-dideoxy-scyllo-inosose
  • smiles:
    • c1(c([n+])c(o)c(o)c(o)c(=o)1)
  • inchi-key:
    • fsugckmutgkwie-ygivhsipsa-o
  • molecular-weight:
    • 162.165

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality