Difference between revisions of "SJ19553"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-602 CPD-602] == * common-name: ** 5-amino-6-(5-phospho-d-ribosylamino)uracil * smiles: ** c...")
(Created page with "Category:gene == Gene SJ19553 == * transcription-direction: ** positive * right-end-position: ** 274822 * left-end-position: ** 270112 * centisome-position: ** 42.75609...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-602 CPD-602] ==
+
== Gene SJ19553 ==
* common-name:
+
* transcription-direction:
** 5-amino-6-(5-phospho-d-ribosylamino)uracil
+
** positive
* smiles:
+
* right-end-position:
** c(op(=o)([o-])[o-])c1(oc(c(o)c(o)1)nc2(=c(n)c(=o)nc(=o)n2))
+
** 274822
* inchi-key:
+
* left-end-position:
** lzexycagpmyxlx-ummcilcdsa-l
+
** 270112
* molecular-weight:
+
* centisome-position:
** 352.197
+
** 42.75609   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RIBOFLAVINSYNREDUC-RXN]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[RIBOFLAVINSYNDEAM-RXN]]
+
* [[2.4.1.141-RXN]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=5-amino-6-(5-phospho-d-ribosylamino)uracil}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=lzexycagpmyxlx-ummcilcdsa-l}}
+
* [[2.4.1.223-RXN]]
{{#set: molecular-weight=352.197}}
+
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[MANNOSYL-CHITO-DOLICHOL-BIOSYNTHESIS]]
 +
** '''16''' reactions found over '''19''' reactions in the full pathway
 +
* [[PWY-6558]]
 +
** '''7''' reactions found over '''13''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=274822}}
 +
{{#set: left-end-position=270112}}
 +
{{#set: centisome-position=42.75609    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=2}}

Latest revision as of 11:01, 18 March 2021

Gene SJ19553

  • transcription-direction:
    • positive
  • right-end-position:
    • 274822
  • left-end-position:
    • 270112
  • centisome-position:
    • 42.75609

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated