Difference between revisions of "SJ19583"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COPROPORPHYRIN_III COPROPORPHYRIN_III] == * common-name: ** coproporphyrin iii * smiles: ** cc1...")
(Created page with "Category:gene == Gene SJ19583 == * transcription-direction: ** negative * right-end-position: ** 21217 * left-end-position: ** 13926 * centisome-position: ** 6.1861715...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COPROPORPHYRIN_III COPROPORPHYRIN_III] ==
+
== Gene SJ19583 ==
* common-name:
+
* transcription-direction:
** coproporphyrin iii
+
** negative
* smiles:
+
* right-end-position:
** cc1(=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(c(ccc(=o)[o-])=c(c)c(=cc(=c(ccc([o-])=o)1)n2)n=3))n4))=n5)))
+
** 21217
* inchi-key:
+
* left-end-position:
** jwfcywsmnrlxlx-ujjxfscmsa-j
+
** 13926
* molecular-weight:
+
* centisome-position:
** 650.687
+
** 6.1861715   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-17518]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[RXN-17517]]
+
* [[RXN-13327]]
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
{{#set: common-name=coproporphyrin iii}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: inchi-key=inchikey=jwfcywsmnrlxlx-ujjxfscmsa-j}}
+
{{#set: transcription-direction=negative}}
{{#set: molecular-weight=650.687}}
+
{{#set: right-end-position=21217}}
 +
{{#set: left-end-position=13926}}
 +
{{#set: centisome-position=6.1861715    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:02, 18 March 2021

Gene SJ19583

  • transcription-direction:
    • negative
  • right-end-position:
    • 21217
  • left-end-position:
    • 13926
  • centisome-position:
    • 6.1861715

Organism(s) associated with this gene

Reaction(s) associated