Difference between revisions of "SJ19604"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ13618 == * transcription-direction: ** positive * right-end-position: ** 172766 * left-end-position: ** 149816 * centisome-position: ** 45.064762...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-ISOVALERYL-COA 3-HYDROXY-ISOVALERYL-COA] == * common-name: ** 3-hydroxyisovaleryl-coa...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ13618 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXY-ISOVALERYL-COA 3-HYDROXY-ISOVALERYL-COA] ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 3-hydroxyisovaleryl-coa
−
* right-end-position:
+
* smiles:
−
** 172766
+
** cc(cop(=o)([o-])op(=o)([o-])occ3(c(c(c(n2(c=nc1(c(=nc=nc=12)n)))o3)o)op([o-])([o-])=o))(c)c(c(nccc(nccsc(=o)cc(c)(c)o)=o)=o)o
−
* left-end-position:
+
* inchi-key:
−
** 149816
+
** pevzkilcbdeobt-uhfffaoysa-j
−
* centisome-position:
+
* molecular-weight:
−
** 45.064762   
+
** 863.619
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[ECH_LPAREN_3hivcoa_RPAREN_]]
−
== Reaction(s) associated ==
+
* [[RXN-14266]]
−
* [[CTPSYN-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[ECH_LPAREN_3hivcoa_RPAREN_]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-14266]]
−
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=3-hydroxyisovaleryl-coa}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=pevzkilcbdeobt-uhfffaoysa-j}}
−
* [[GLUTAMIN-RXN]]
+
{{#set: molecular-weight=863.619}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-14325]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7185]]
 
−
** '''5''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-7176]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-7177]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
* [[CITRULBIO-PWY]]
 
−
** '''7''' reactions found over '''8''' reactions in the full pathway
 
−
* [[GLUTAMINDEG-PWY]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=172766}}
 
−
{{#set: left-end-position=149816}}
 
−
{{#set: centisome-position=45.064762    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 
−
{{#set: nb pathway associated=5}}
 

Revision as of 09:25, 27 August 2019

Metabolite 3-HYDROXY-ISOVALERYL-COA

  • common-name:
    • 3-hydroxyisovaleryl-coa
  • smiles:
    • cc(cop(=o)([o-])op(=o)([o-])occ3(c(c(c(n2(c=nc1(c(=nc=nc=12)n)))o3)o)op([o-])([o-])=o))(c)c(c(nccc(nccsc(=o)cc(c)(c)o)=o)=o)o
  • inchi-key:
    • pevzkilcbdeobt-uhfffaoysa-j
  • molecular-weight:
    • 863.619

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ19604&oldid=29283"