Difference between revisions of "SJ19607"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ10778 == * transcription-direction: ** negative * right-end-position: ** 60719 * left-end-position: ** 20623 * centisome-position: ** 5.361177...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETO-ADIPYL-COA 3-KETO-ADIPYL-COA] == * common-name: ** 3-oxoadipyl-coa * smiles: ** cc(c)(c(...")
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ10778 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETO-ADIPYL-COA 3-KETO-ADIPYL-COA] ==
* transcription-direction:
+
* common-name:
** negative
+
** 3-oxoadipyl-coa
* right-end-position:
+
* smiles:
** 60719
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 20623
+
** vkkkaapgxhwxoo-biewrjsysa-i
* centisome-position:
+
* molecular-weight:
** 5.361177   
+
** 904.605
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN0-2044]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
+
* [[RXN0-2044]]
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=3-oxoadipyl-coa}}
{{#set: transcription-direction=negative}}
+
{{#set: inchi-key=inchikey=vkkkaapgxhwxoo-biewrjsysa-i}}
{{#set: right-end-position=60719}}
+
{{#set: molecular-weight=904.605}}
{{#set: left-end-position=20623}}
 
{{#set: centisome-position=5.361177    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Revision as of 14:20, 26 August 2019

Metabolite 3-KETO-ADIPYL-COA

  • common-name:
    • 3-oxoadipyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc([o-])=o)=o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • vkkkaapgxhwxoo-biewrjsysa-i
  • molecular-weight:
    • 904.605

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality