Difference between revisions of "SJ19612"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FADH2 FADH2] == * common-name: ** fadh2 * smiles: ** cc1(=c(c)c=c2(n(c3(nc(nc(=o)c(nc(=c1)2)=3)...")
 
(Created page with "Category:gene == Gene SJ19612 == * transcription-direction: ** positive * right-end-position: ** 77165 * left-end-position: ** 60840 * centisome-position: ** 27.132977...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FADH2 FADH2] ==
+
== Gene SJ19612 ==
* common-name:
+
* transcription-direction:
** fadh2
+
** positive
* smiles:
+
* right-end-position:
** cc1(=c(c)c=c2(n(c3(nc(nc(=o)c(nc(=c1)2)=3)=o))cc(o)c(o)c(o)cop(op([o-])(occ6(c(o)c(o)c(n5(c=nc4(c(n)=nc=nc=45)))o6))=o)([o-])=o))
+
** 77165
* inchi-key:
+
* left-end-position:
** ypzrhbjkemoyqh-uybvjogssa-l
+
** 60840
* molecular-weight:
+
* centisome-position:
** 785.556
+
** 27.132977   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[ACOAD1f]]
+
* [[S.japonica_carotenoid_curated]]
* [[PPCOAOm]]
+
== Reaction(s) associated ==
* [[RXN-14264]]
+
* [[ATPASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
* [[ACOA120OR]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[ACOA140OR]]
+
* [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
* [[ACOA160OR]]
+
** Category: [[annotation]]
* [[ACOA40OR]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[ACOA80OR]]
+
* [[RXN-12195]]
* [[ACOAD1f]]
+
** Category: [[annotation]]
* [[IVCDH]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[MCDH]]
+
* [[RXN-12196]]
* [[MCDH_LPAREN_2mb2coa_RPAREN_]]
+
** Category: [[annotation]]
* [[PPCOAOm]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-14264]]
+
* [[RXN0-5462]]
* [[SUCDHm]]
+
** Category: [[annotation]]
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: common-name=fadh2}}
+
== Pathway(s) associated ==
{{#set: inchi-key=inchikey=ypzrhbjkemoyqh-uybvjogssa-l}}
+
* [[PWY-6545]]
{{#set: molecular-weight=785.556}}
+
** '''8''' reactions found over '''9''' reactions in the full pathway
 +
* [[PWY-7210]]
 +
** '''8''' reactions found over '''8''' reactions in the full pathway
 +
* [[PWY-7198]]
 +
** '''6''' reactions found over '''7''' reactions in the full pathway
 +
* [[PWY-7184]]
 +
** '''9''' reactions found over '''9''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=77165}}
 +
{{#set: left-end-position=60840}}
 +
{{#set: centisome-position=27.132977    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=5}}
 +
{{#set: nb pathway associated=4}}

Latest revision as of 11:02, 18 March 2021

Gene SJ19612

  • transcription-direction:
    • positive
  • right-end-position:
    • 77165
  • left-end-position:
    • 60840
  • centisome-position:
    • 27.132977

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6545
    • 8 reactions found over 9 reactions in the full pathway
  • PWY-7210
    • 8 reactions found over 8 reactions in the full pathway
  • PWY-7198
    • 6 reactions found over 7 reactions in the full pathway
  • PWY-7184
    • 9 reactions found over 9 reactions in the full pathway