Difference between revisions of "SJ19612"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=16-HYDROXYPALMITATE 16-HYDROXYPALMITATE] == * common-name: ** 16-hydroxypalmitate * smiles: **...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15435 CPD-15435] == * common-name: ** l-threonylcarbamoyladenylate * smiles: ** cc(o)c(c([o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=16-HYDROXYPALMITATE 16-HYDROXYPALMITATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15435 CPD-15435] ==
 
* common-name:
 
* common-name:
** 16-hydroxypalmitate
+
** l-threonylcarbamoyladenylate
 
* smiles:
 
* smiles:
** c(ccccccccccccccc([o-])=o)o
+
** cc(o)c(c([o-])=o)nc(=o)op(occ3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))([o-])=o
 
* inchi-key:
 
* inchi-key:
** ugagpnkcdrtdhp-uhfffaoysa-m
+
** ghlupquheijrcu-dwvddhqfsa-l
 
* molecular-weight:
 
* molecular-weight:
** 271.419
+
** 490.322
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16389]]
+
* [[RXN-14569]]
 +
* [[RXN-14570]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14569]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=16-hydroxypalmitate}}
+
{{#set: common-name=l-threonylcarbamoyladenylate}}
{{#set: inchi-key=inchikey=ugagpnkcdrtdhp-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=ghlupquheijrcu-dwvddhqfsa-l}}
{{#set: molecular-weight=271.419}}
+
{{#set: molecular-weight=490.322}}

Revision as of 09:24, 27 August 2019

Metabolite CPD-15435

  • common-name:
    • l-threonylcarbamoyladenylate
  • smiles:
    • cc(o)c(c([o-])=o)nc(=o)op(occ3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))([o-])=o
  • inchi-key:
    • ghlupquheijrcu-dwvddhqfsa-l
  • molecular-weight:
    • 490.322

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality