Difference between revisions of "SJ19766"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OLEATE-CPD OLEATE-CPD] == * common-name: ** oleate * smiles: ** ccccccccc=ccccccccc([o-])=o * i...") |
(Created page with "Category:gene == Gene SJ19766 == * transcription-direction: ** negative * right-end-position: ** 118989 * left-end-position: ** 111201 * centisome-position: ** 50.499313...") |
||
(7 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:gene]] |
− | == | + | == Gene SJ19766 == |
− | * | + | * transcription-direction: |
− | ** | + | ** negative |
− | * | + | * right-end-position: |
− | ** | + | ** 118989 |
− | * | + | * left-end-position: |
− | ** | + | ** 111201 |
− | * | + | * centisome-position: |
− | ** | + | ** 50.499313 |
− | == Reaction(s) | + | == Organism(s) associated with this gene == |
− | * [[ | + | * [[S.japonica_carotenoid_curated]] |
− | * [[ | + | == Reaction(s) associated == |
− | * [[RXN- | + | * [[PEROXID-RXN]] |
− | * [[ | + | ** Category: [[annotation]] |
− | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
− | * [[ | + | * [[RXN-14240]] |
− | * [[RXN- | + | ** Category: [[annotation]] |
− | * [[ | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
− | * [[ | + | * [[RXN-15288]] |
− | * [[RXN- | + | ** Category: [[annotation]] |
− | * [[ | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
− | * [[ | + | * [[RXN-17352]] |
− | * [[RXN- | + | ** Category: [[annotation]] |
− | * [[ | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
− | * [[ | + | * [[RXN-8635]] |
− | == | + | ** Category: [[annotation]] |
− | {{#set: | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
− | {{#set: | + | == Pathway(s) associated == |
− | {{#set: | + | * [[PWY-7214]] |
+ | ** '''1''' reactions found over '''2''' reactions in the full pathway | ||
+ | * [[PWY-7445]] | ||
+ | ** '''1''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PWY-5466]] | ||
+ | ** '''2''' reactions found over '''10''' reactions in the full pathway | ||
+ | * [[PWY-6824]] | ||
+ | ** '''2''' reactions found over '''10''' reactions in the full pathway | ||
+ | * [[PWY-5469]] | ||
+ | ** '''2''' reactions found over '''8''' reactions in the full pathway | ||
+ | * [[PWY-5461]] | ||
+ | ** '''1''' reactions found over '''1''' reactions in the full pathway | ||
+ | {{#set: transcription-direction=negative}} | ||
+ | {{#set: right-end-position=118989}} | ||
+ | {{#set: left-end-position=111201}} | ||
+ | {{#set: centisome-position=50.499313 }} | ||
+ | {{#set: organism associated=S.japonica_carotenoid_curated}} | ||
+ | {{#set: nb reaction associated=5}} | ||
+ | {{#set: nb pathway associated=6}} |
Latest revision as of 11:01, 18 March 2021
Contents
Gene SJ19766
- transcription-direction:
- negative
- right-end-position:
- 118989
- left-end-position:
- 111201
- centisome-position:
- 50.499313
Organism(s) associated with this gene
Reaction(s) associated
- PEROXID-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- RXN-14240
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- RXN-15288
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- RXN-17352
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- RXN-8635
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
Pathway(s) associated
- PWY-7214
- 1 reactions found over 2 reactions in the full pathway
- PWY-7445
- 1 reactions found over 4 reactions in the full pathway
- PWY-5466
- 2 reactions found over 10 reactions in the full pathway
- PWY-6824
- 2 reactions found over 10 reactions in the full pathway
- PWY-5469
- 2 reactions found over 8 reactions in the full pathway
- PWY-5461
- 1 reactions found over 1 reactions in the full pathway