Difference between revisions of "SJ19782"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR] == * common-name: ** 2,5...")
(Created page with "Category:gene == Gene SJ19782 == * transcription-direction: ** negative * right-end-position: ** 328890 * left-end-position: ** 325223 * centisome-position: ** 51.560093...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR] ==
+
== Gene SJ19782 ==
* common-name:
+
* transcription-direction:
** 2,5-diamino-6-(5-phospho-d-ribosylamino)pyrimidin-4(3h)-one
+
** negative
* smiles:
+
* right-end-position:
** c(c2(c(o)c(o)c(nc1(=c(n)c(=o)nc(=n1)n))o2))op(=o)([o-])[o-]
+
** 328890
* inchi-key:
+
* left-end-position:
** oclclrxknjcojd-ummcilcdsa-l
+
** 325223
* molecular-weight:
+
* centisome-position:
** 351.212
+
** 51.560093   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RIBOFLAVINSYNDEAM-RXN]]
+
* [[S.japonica_carotenoid_curated]]
* [[RXN-10057]]
+
== Reaction(s) associated ==
* [[RXN-14171]]
+
* [[RXN0-2584]]
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
* [[GTP-CYCLOHYDRO-II-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-14171]]
+
{{#set: transcription-direction=negative}}
== Reaction(s) of unknown directionality ==
+
{{#set: right-end-position=328890}}
{{#set: common-name=2,5-diamino-6-(5-phospho-d-ribosylamino)pyrimidin-4(3h)-one}}
+
{{#set: left-end-position=325223}}
{{#set: inchi-key=inchikey=oclclrxknjcojd-ummcilcdsa-l}}
+
{{#set: centisome-position=51.560093    }}
{{#set: molecular-weight=351.212}}
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:01, 18 March 2021

Gene SJ19782

  • transcription-direction:
    • negative
  • right-end-position:
    • 328890
  • left-end-position:
    • 325223
  • centisome-position:
    • 51.560093

Organism(s) associated with this gene

Reaction(s) associated