Difference between revisions of "SJ19787"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYADIPYL-COA 3-HYDROXYADIPYL-COA] == * common-name: ** (3s)-hydroxyadipyl-coa * smiles:...")
(Created page with "Category:gene == Gene SJ19787 == * transcription-direction: ** positive * right-end-position: ** 469261 * left-end-position: ** 466508 * centisome-position: ** 73.95908...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYADIPYL-COA 3-HYDROXYADIPYL-COA] ==
+
== Gene SJ19787 ==
−
* common-name:
+
* transcription-direction:
−
** (3s)-hydroxyadipyl-coa
+
** positive
−
* smiles:
+
* right-end-position:
−
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cc(ccc(=o)[o-])o)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** 469261
−
* inchi-key:
+
* left-end-position:
−
** oteacgaedcimbs-notshufbsa-i
+
** 466508
−
* molecular-weight:
+
* centisome-position:
−
** 906.621
+
** 73.95908   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[RXN-2425]]
+
* [[S.japonica_carotenoid_curated]]
−
* [[RXN0-2044]]
+
== Reaction(s) associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[2.7.10.1-RXN]]
−
* [[RXN-2425]]
+
** Category: [[annotation]]
−
* [[RXN0-2044]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
== Reaction(s) of unknown directionality ==
+
* [[2.7.12.1-RXN]]
−
{{#set: common-name=(3s)-hydroxyadipyl-coa}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=oteacgaedcimbs-notshufbsa-i}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=906.621}}
+
* [[PROTEIN-KINASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RXN-14906]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=469261}}
 +
{{#set: left-end-position=466508}}
 +
{{#set: centisome-position=73.95908    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=4}}

Latest revision as of 11:03, 18 March 2021

Gene SJ19787

  • transcription-direction:
    • positive
  • right-end-position:
    • 469261
  • left-end-position:
    • 466508
  • centisome-position:
    • 73.95908

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ19787&oldid=133024"