Difference between revisions of "SJ19789"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLUCARATE D-GLUCARATE] == * common-name: ** d-glucarate * smiles: ** c(=o)(c(o)c(o)c(o)c(o)c(...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-pseudouridine13 tRNA-pseudouridine13] == * common-name: ** a pseudouridine13 in trna == Re...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLUCARATE D-GLUCARATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-pseudouridine13 tRNA-pseudouridine13] ==
 
* common-name:
 
* common-name:
** d-glucarate
+
** a pseudouridine13 in trna
* smiles:
 
** c(=o)(c(o)c(o)c(o)c(o)c(=o)[o-])[o-]
 
* inchi-key:
 
** dslzvsrjtyrbfb-lleiaeiesa-l
 
* molecular-weight:
 
** 208.124
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14225]]
+
* [[RXN-11841]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-glucarate}}
+
{{#set: common-name=a pseudouridine13 in trna}}
{{#set: inchi-key=inchikey=dslzvsrjtyrbfb-lleiaeiesa-l}}
 
{{#set: molecular-weight=208.124}}
 

Revision as of 14:19, 26 August 2019

Metabolite tRNA-pseudouridine13

  • common-name:
    • a pseudouridine13 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality