Difference between revisions of "SJ19789"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-pseudouridine13 tRNA-pseudouridine13] == * common-name: ** a pseudouridine13 in trna == Re...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17540 CPD-17540] == * common-name: ** dapdiamide b * smiles: ** ccc(c)c(c([o-])=o)nc(c(cnc(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-pseudouridine13 tRNA-pseudouridine13] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17540 CPD-17540] ==
 
* common-name:
 
* common-name:
** a pseudouridine13 in trna
+
** dapdiamide b
 +
* smiles:
 +
** ccc(c)c(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o
 +
* inchi-key:
 +
** wsfqksibzodgpb-ofaneystsa-n
 +
* molecular-weight:
 +
** 314.341
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11841]]
+
* [[RXN-16292]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a pseudouridine13 in trna}}
+
{{#set: common-name=dapdiamide b}}
 +
{{#set: inchi-key=inchikey=wsfqksibzodgpb-ofaneystsa-n}}
 +
{{#set: molecular-weight=314.341}}

Revision as of 09:23, 27 August 2019

Metabolite CPD-17540

  • common-name:
    • dapdiamide b
  • smiles:
    • ccc(c)c(c([o-])=o)nc(c(cnc(=o)c=cc(n)=o)[n+])=o
  • inchi-key:
    • wsfqksibzodgpb-ofaneystsa-n
  • molecular-weight:
    • 314.341

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality