Difference between revisions of "SJ19843"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5-PHOSPHORIBOSYL-ANTHRANILATE N-5-PHOSPHORIBOSYL-ANTHRANILATE] == * common-name: ** n-(5-phos...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14705 CPD-14705] == * common-name: ** 4-hydroxy-2-nonenal-[cys-gly] conjugate * smiles: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5-PHOSPHORIBOSYL-ANTHRANILATE N-5-PHOSPHORIBOSYL-ANTHRANILATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14705 CPD-14705] ==
 
* common-name:
 
* common-name:
** n-(5-phosphoribosyl)-anthranilate
+
** 4-hydroxy-2-nonenal-[cys-gly] conjugate
 
* smiles:
 
* smiles:
** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)nc2(c=cc=cc(c(=o)[o-])=2))
+
** cccccc(o)c(c[ch]=o)scc([n+])c(=o)ncc([o-])=o
 
* inchi-key:
 
* inchi-key:
** pmfmjxprnjuymb-gwofurmssa-k
+
** lqtwzqsulmrbee-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 346.21
+
** 334.43
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PRAISOM-RXN]]
+
* [[RXN-13677]]
* [[PRTRANS-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PRTRANS-RXN]]
+
* [[RXN-13675]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-(5-phosphoribosyl)-anthranilate}}
+
{{#set: common-name=4-hydroxy-2-nonenal-[cys-gly] conjugate}}
{{#set: inchi-key=inchikey=pmfmjxprnjuymb-gwofurmssa-k}}
+
{{#set: inchi-key=inchikey=lqtwzqsulmrbee-uhfffaoysa-n}}
{{#set: molecular-weight=346.21}}
+
{{#set: molecular-weight=334.43}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-14705

  • common-name:
    • 4-hydroxy-2-nonenal-[cys-gly] conjugate
  • smiles:
    • cccccc(o)c(c[ch]=o)scc([n+])c(=o)ncc([o-])=o
  • inchi-key:
    • lqtwzqsulmrbee-uhfffaoysa-n
  • molecular-weight:
    • 334.43

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "4-hydroxy-2-nonenal-[cys-gly] conjugate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.