Difference between revisions of "SJ19900"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite XANTHOSINE == * common-name: ** xanthosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc(=o)nc=23))) * inchi-key: ** ubortcndukbeop-u...") |
(Created page with "Category:gene == Gene SJ19900 == * transcription-direction: ** positive * right-end-position: ** 199456 * left-end-position: ** 188860 * centisome-position: ** 30.26297...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:gene]] |
| − | == | + | == Gene SJ19900 == |
| − | * | + | * transcription-direction: |
| − | ** | + | ** positive |
| − | * | + | * right-end-position: |
| − | ** | + | ** 199456 |
| − | * | + | * left-end-position: |
| − | ** | + | ** 188860 |
| − | * | + | * centisome-position: |
| − | ** | + | ** 30.26297 |
| − | == Reaction(s) | + | == Organism(s) associated with this gene == |
| − | * [[ | + | * [[S.japonica_carotenoid_curated]] |
| − | * [[ | + | == Reaction(s) associated == |
| − | + | * [[2.7.11.18-RXN]] | |
| − | * [[ | + | ** Category: [[annotation]] |
| − | * [[ | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
| − | + | * [[PROTEIN-KINASE-RXN]] | |
| − | {{#set: | + | ** Category: [[annotation]] |
| − | {{#set: | + | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a |
| − | {{#set: | + | ** Category: [[orthology]] |
| + | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | ||
| + | {{#set: transcription-direction=positive}} | ||
| + | {{#set: right-end-position=199456}} | ||
| + | {{#set: left-end-position=188860}} | ||
| + | {{#set: centisome-position=30.26297 }} | ||
| + | {{#set: organism associated=S.japonica_carotenoid_curated}} | ||
| + | {{#set: nb reaction associated=2}} | ||
Latest revision as of 11:10, 18 March 2021
Gene SJ19900
- transcription-direction:
- positive
- right-end-position:
- 199456
- left-end-position:
- 188860
- centisome-position:
- 30.26297
Organism(s) associated with this gene
Reaction(s) associated
- 2.7.11.18-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: annotation
- PROTEIN-KINASE-RXN
- Category: annotation
- source: saccharina_japonica_genome; tool: pathwaytools; comment: n.a
- Category: orthology
- source: output_pantograph_ectocarpus_siliculosus; tool: pantograph; comment: n.a
- Category: annotation
