Difference between revisions of "SJ19931"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DELTA-TOCOPHEROL DELTA-TOCOPHEROL] == * common-name: ** δ-tocopherol * smiles: ** cc(c)cc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Alpha-D-Mannosides Alpha-D-Mannosides] == * common-name: ** an α-d-mannoside == Reaction(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DELTA-TOCOPHEROL DELTA-TOCOPHEROL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Alpha-D-Mannosides Alpha-D-Mannosides] ==
 
* common-name:
 
* common-name:
** δ-tocopherol
+
** an α-d-mannoside
* smiles:
 
** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=cc(=c(o1)2)c))
 
* inchi-key:
 
** gzifeoyasatjeh-vhfrwlagsa-n
 
* molecular-weight:
 
** 402.659
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-2562]]
+
* [[3.2.1.24-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=δ-tocopherol}}
+
{{#set: common-name=an α-d-mannoside}}
{{#set: inchi-key=inchikey=gzifeoyasatjeh-vhfrwlagsa-n}}
 
{{#set: molecular-weight=402.659}}
 

Revision as of 14:19, 26 August 2019

Metabolite Alpha-D-Mannosides

  • common-name:
    • an α-d-mannoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality