Difference between revisions of "SJ19938"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13188 CPD-13188] == * common-name: ** β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-O-Methylguanosine18 2-O-Methylguanosine18] == * common-name: ** a 2'-o-methylguanosine18 in t...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13188 CPD-13188] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-O-Methylguanosine18 2-O-Methylguanosine18] ==
 
* common-name:
 
* common-name:
−
** β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-glcp
+
** a 2'-o-methylguanosine18 in trna
−
* smiles:
 
−
** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)c(o)3)o))
 
−
* inchi-key:
 
−
** cwvrqjbcbctflt-civpzrojsa-n
 
−
* molecular-weight:
 
−
** 488.442
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-12270]]
+
* [[2.1.1.34-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=β-d-glcp-(1→4)-α-l-rhap-(1→3)-d-glcp}}
+
{{#set: common-name=a 2'-o-methylguanosine18 in trna}}
−
{{#set: inchi-key=inchikey=cwvrqjbcbctflt-civpzrojsa-n}}
 
−
{{#set: molecular-weight=488.442}}
 

Revision as of 09:23, 27 August 2019

Metabolite 2-O-Methylguanosine18

  • common-name:
    • a 2'-o-methylguanosine18 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ19938&oldid=27767"