Difference between revisions of "SJ20019"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DAMP DAMP] == * common-name: ** damp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op...")
(Created page with "Category:gene == Gene SJ20019 == * transcription-direction: ** positive * right-end-position: ** 120061 * left-end-position: ** 107040 * centisome-position: ** 49.588387...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DAMP DAMP] ==
+
== Gene SJ20019 ==
* common-name:
+
* transcription-direction:
** damp
+
** positive
* smiles:
+
* right-end-position:
** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op([o-])([o-])=o
+
** 120061
* inchi-key:
+
* left-end-position:
** khwchtkseggwex-rrkcrqdmsa-l
+
** 107040
* molecular-weight:
+
* centisome-position:
** 329.208
+
** 49.588387   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[ATDAM]]
+
* [[S.japonica_carotenoid_curated]]
* [[DAMPH]]
+
== Reaction(s) associated ==
* [[DEOXYADENYLATE-KINASE-RXN]]
+
* [[DOPAMINE-BETA-MONOOXYGENASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
* [[DAMPH]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[RXN-14195]]
+
== Pathway(s) associated ==
* [[RXN-14215]]
+
* [[PWY66-301]]
* [[RXN0-384]]
+
** '''2''' reactions found over '''4''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
{{#set: transcription-direction=positive}}
{{#set: common-name=damp}}
+
{{#set: right-end-position=120061}}
{{#set: inchi-key=inchikey=khwchtkseggwex-rrkcrqdmsa-l}}
+
{{#set: left-end-position=107040}}
{{#set: molecular-weight=329.208}}
+
{{#set: centisome-position=49.588387    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:04, 18 March 2021

Gene SJ20019

  • transcription-direction:
    • positive
  • right-end-position:
    • 120061
  • left-end-position:
    • 107040
  • centisome-position:
    • 49.588387

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY66-301
    • 2 reactions found over 4 reactions in the full pathway