Difference between revisions of "SJ20035"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TMP TMP] == * common-name: ** dtmp * smiles: ** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])[o-...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2106 CPD0-2106] == * common-name: ** 3-oxooctanoyl-coa * smiles: ** cccccc(=o)cc(=o)sccnc(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TMP TMP] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2106 CPD0-2106] ==
 
* common-name:
 
* common-name:
** dtmp
+
** 3-oxooctanoyl-coa
 
* smiles:
 
* smiles:
** cc1(=cn(c(=o)nc(=o)1)c2(cc(o)c(cop(=o)([o-])[o-])o2))
+
** cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** gyozywvxfndglu-xlpzgreqsa-l
+
** wpivbcgrgvnddt-cecatxlmsa-j
 
* molecular-weight:
 
* molecular-weight:
** 320.195
+
** 903.684
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ATDTM]]
+
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
* [[DTMPKI-RXN]]
+
* [[RXN-14277]]
* [[MDUMT]]
 
* [[TPH]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[MDUMT]]
+
* [[RXN-13279-CPD-14916/NADP//CPD0-2106/NADPH/PROTON.39.]]
* [[RXN-14200]]
+
* [[RXN-14275]]
* [[RXN-14213]]
+
* [[RXN-14277]]
* [[RXN0-5107]]
 
* [[THYMIDYLATESYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dtmp}}
+
{{#set: common-name=3-oxooctanoyl-coa}}
{{#set: inchi-key=inchikey=gyozywvxfndglu-xlpzgreqsa-l}}
+
{{#set: inchi-key=inchikey=wpivbcgrgvnddt-cecatxlmsa-j}}
{{#set: molecular-weight=320.195}}
+
{{#set: molecular-weight=903.684}}

Revision as of 09:24, 27 August 2019

Metabolite CPD0-2106

  • common-name:
    • 3-oxooctanoyl-coa
  • smiles:
    • cccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • wpivbcgrgvnddt-cecatxlmsa-j
  • molecular-weight:
    • 903.684

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality