Difference between revisions of "SJ20055"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ21701 == * transcription-direction: ** positive * right-end-position: ** 1008890 * left-end-position: ** 957947 * centisome-position: ** 84.68362...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15686 CPD-15686] == * common-name: ** (3r)-hydroxy- 5-cis, 7-trans-tetradecadienoyl-coa * s...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ21701 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15686 CPD-15686] ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** (3r)-hydroxy- 5-cis, 7-trans-tetradecadienoyl-coa
−
* right-end-position:
+
* smiles:
−
** 1008890
+
** ccccccc=cc=ccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
* left-end-position:
+
* inchi-key:
−
** 957947
+
** zzvzpdqtnsjqpz-voxmgfccsa-j
−
* centisome-position:
+
* molecular-weight:
−
** 84.68362   
+
** 985.829
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-14797]]
−
* [[2OXOGLUTDECARB-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=(3r)-hydroxy- 5-cis, 7-trans-tetradecadienoyl-coa}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=zzvzpdqtnsjqpz-voxmgfccsa-j}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=985.829}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[AKGDHmi]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY66-398]]
 
−
** '''10''' reactions found over '''11''' reactions in the full pathway
 
−
* [[PWY-5084]]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=1008890}}
 
−
{{#set: left-end-position=957947}}
 
−
{{#set: centisome-position=84.68362    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=2}}
 

Revision as of 09:25, 27 August 2019

Metabolite CPD-15686

  • common-name:
    • (3r)-hydroxy- 5-cis, 7-trans-tetradecadienoyl-coa
  • smiles:
    • ccccccc=cc=ccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • zzvzpdqtnsjqpz-voxmgfccsa-j
  • molecular-weight:
    • 985.829

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ20055&oldid=29291"