Difference between revisions of "SJ20083"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARNITINE CARNITINE] == * common-name: ** l-carnitine * smiles: ** c(c(o)cc(=o)[o-])[n+](c)(c)c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-D-Galactosides Beta-D-Galactosides] == * common-name: ** a β-d-galactoside == Reactio...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARNITINE CARNITINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Beta-D-Galactosides Beta-D-Galactosides] ==
 
* common-name:
 
* common-name:
** l-carnitine
+
** a β-d-galactoside
* smiles:
 
** c(c(o)cc(=o)[o-])[n+](c)(c)c
 
* inchi-key:
 
** phiqhxfuzvpyii-zcfiwibfsa-n
 
* molecular-weight:
 
** 161.2
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
+
* [[3.2.1.23-RXN]]
* [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]]
 
* [[RXN-9918]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.14.11.1-RXN]]
 
* [[CARNITINE-O-ACETYLTRANSFERASE-RXN]]
 
* [[CARNITINE-O-PALMITOYLTRANSFERASE-RXN]]
 
* [[RXN-9918]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-carnitine}}
+
{{#set: common-name=a β-d-galactoside}}
{{#set: inchi-key=inchikey=phiqhxfuzvpyii-zcfiwibfsa-n}}
 
{{#set: molecular-weight=161.2}}
 

Revision as of 14:20, 26 August 2019

Metabolite Beta-D-Galactosides

  • common-name:
    • a β-d-galactoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality