Difference between revisions of "SJ20146"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12119 CPD-12119] == * common-name: ** demethylmenaquinol-10 * smiles: ** cc(=cccc(=cccc(c)=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEU-tRNAs LEU-tRNAs] == * common-name: ** a trnaleu == Reaction(s) known to consume the compoun...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12119 CPD-12119] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LEU-tRNAs LEU-tRNAs] ==
 
* common-name:
 
* common-name:
** demethylmenaquinol-10
+
** a trnaleu
* smiles:
 
** cc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c
 
* inchi-key:
 
** fnbtzsjwsslppl-alcxcgrtsa-n
 
* molecular-weight:
 
** 841.354
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9361]]
+
* [[LEUCINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=demethylmenaquinol-10}}
+
{{#set: common-name=a trnaleu}}
{{#set: inchi-key=inchikey=fnbtzsjwsslppl-alcxcgrtsa-n}}
 
{{#set: molecular-weight=841.354}}
 

Revision as of 14:19, 26 August 2019

Metabolite LEU-tRNAs

  • common-name:
    • a trnaleu

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality