|
|
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ09945 == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-40 CPDQT-40] == |
| − | * transcription-direction:
| + | * common-name: |
| − | ** positive
| + | ** 3-[(7'-methylthio)heptyl]malate |
| − | * right-end-position:
| + | * smiles: |
| − | ** 244797
| + | ** cscccccccc(c(o)c(=o)[o-])c(=o)[o-] |
| − | * left-end-position:
| + | * inchi-key: |
| − | ** 217669
| + | ** sxljfgxgvbwoob-uhfffaoysa-l |
| − | * centisome-position:
| + | * molecular-weight: |
| − | ** 54.161472
| + | ** 276.347 |
| − | == Organism(s) associated with this gene ==
| + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]]
| + | * [[RXN-18200]] |
| − | == Reaction(s) associated ==
| + | * [[RXNQT-4178]] |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) known to produce the compound == |
| − | * [[2.5.1.41-RXN]] | + | * [[RXN-18200]] |
| − | ** Category: [[orthology]]
| + | == Reaction(s) of unknown directionality == |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | + | {{#set: common-name=3-[(7'-methylthio)heptyl]malate}} |
| − | * [[CYCLOARTENOL-SYNTHASE-RXN]]
| + | {{#set: inchi-key=inchikey=sxljfgxgvbwoob-uhfffaoysa-l}} |
| − | ** Category: [[annotation]] | + | {{#set: molecular-weight=276.347}} |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
| |
| − | *** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[FPPSYN-RXN]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[GPPSYN-RXN]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[LANOSTEROL-SYNTHASE-RXN]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | * [[RXN-7810]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-7811]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | * [[RXN-7813]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | </div>
| |
| − | == Pathway(s) associated == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * [[PWY-6349]] | |
| − | ** '''2''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[PWY-6115]] | |
| − | ** '''1''' reactions found over '''n.a''' reactions in the full pathway
| |
| − | * [[PWY-7154]] | |
| − | ** '''2''' reactions found over '''11''' reactions in the full pathway
| |
| − | * [[PWY-7155]]
| |
| − | ** '''4''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[PWY-6098]]
| |
| − | ** '''2''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-2541]]
| |
| − | ** '''11''' reactions found over '''35''' reactions in the full pathway
| |
| − | * [[PWY-6109]]
| |
| − | ** '''1''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[PWY-6859]]
| |
| − | ** '''3''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7736]]
| |
| − | ** '''3''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-7102]]
| |
| − | ** '''3''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[PWY-7721]]
| |
| − | ** '''2''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-5123]]
| |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-6383]]
| |
| − | ** '''2''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-7410]]
| |
| − | ** '''1''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-5122]]
| |
| − | ** '''1''' reactions found over '''1''' reactions in the full pathway
| |
| − | * [[PWY-7141]]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-7659]]
| |
| − | ** '''1''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-7709]]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-7182]]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-6132]]
| |
| − | ** '''1''' reactions found over '''1''' reactions in the full pathway
| |
| − | * [[PWY-5808]]
| |
| − | ** '''3''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-5132]]
| |
| − | ** '''2''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[PWY-5133]]
| |
| − | ** '''1''' reactions found over '''6''' reactions in the full pathway
| |
| − | </div>
| |
| − | {{#set: transcription-direction=positive}}
| |
| − | {{#set: right-end-position=244797}} | |
| − | {{#set: left-end-position=217669}}
| |
| − | {{#set: centisome-position=54.161472 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}}
| |
| − | {{#set: nb reaction associated=8}}
| |
| − | {{#set: nb pathway associated=23}}
| |
