Difference between revisions of "SJ20238"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14018 CPD-14018] == * common-name: ** icosapentaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18077 CPD-18077] == * common-name: ** glc3man9glcnac2-[protein] == Reaction(s) known to con...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14018 CPD-14018] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18077 CPD-18077] ==
 
* common-name:
 
* common-name:
** icosapentaenoyl-coa
+
** glc3man9glcnac2-[protein]
* smiles:
 
** ccc=ccc=ccc=ccc=ccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** jwzlrycddxhxdl-lcmhirpzsa-j
 
* molecular-weight:
 
** 1047.943
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13430]]
+
* [[3.2.1.106-RXN]]
* [[RXN-17688]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12978]]
+
* [[2.4.1.119-RXN]]
* [[RXN-17688]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=icosapentaenoyl-coa}}
+
{{#set: common-name=glc3man9glcnac2-[protein]}}
{{#set: inchi-key=inchikey=jwzlrycddxhxdl-lcmhirpzsa-j}}
 
{{#set: molecular-weight=1047.943}}
 

Revision as of 14:19, 26 August 2019

Metabolite CPD-18077

  • common-name:
    • glc3man9glcnac2-[protein]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "glc3man9glcnac2-[protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.